CymitQuimica logo

CAS 111423-27-9

:

(S)-(-)-1,1,1-TRIFLUORODECAN-2-OL

Description:
(S)-(-)-1,1,1-Trifluorodecan-2-ol is a chiral alcohol characterized by the presence of a trifluoromethyl group and a hydroxyl group on a decane backbone. The trifluoromethyl group significantly influences its chemical properties, enhancing its polarity and making it a useful compound in various applications, including pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its solubility in polar solvents and its ability to participate in hydrogen bonding, which can affect its reactivity and interactions with other molecules. As a chiral compound, it exists in two enantiomeric forms, with the (S)-(-) configuration being one of them, which can lead to different biological activities and properties compared to its (R)-(+)-counterpart. The compound's unique structure and properties make it a subject of interest in synthetic organic chemistry and materials science. Additionally, its CAS number, 111423-27-9, allows for easy identification and reference in chemical databases and literature.
Formula:C10H19F3O
InChI:InChI=1/C10H19F3O/c1-2-3-4-5-6-7-8-9(14)10(11,12)13/h9,14H,2-8H2,1H3
SMILES:CCCCCCCCC(C(F)(F)F)O
Synonyms:
  • (S)-(-)-1,1,1-Trifluorodecan-2-ol(>98%ee)
  • 1,1,1-Trifluorodecan-2-Ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.