CAS 111453-32-8
:3-Amino-5-[[(2,3-dihydroxypropyl)amino]carbonyl]-2,4,6-triiodobenzoic acid
Description:
3-Amino-5-[[(2,3-dihydroxypropyl)amino]carbonyl]-2,4,6-triiodobenzoic acid, with CAS number 111453-32-8, is a complex organic compound characterized by its multiple functional groups and iodine substituents. This substance features a benzoic acid core with three iodine atoms attached to the aromatic ring, which significantly influences its chemical properties, including increased molecular weight and potential for enhanced biological activity. The presence of an amino group and a dihydroxypropyl chain suggests that it may exhibit both hydrophilic and hydrophobic characteristics, potentially affecting its solubility in various solvents. The compound's structure indicates it could participate in hydrogen bonding due to the hydroxyl groups, which may enhance its reactivity and interaction with biological systems. Additionally, the triiodobenzoic acid moiety may have applications in medical imaging or as a contrast agent due to the high atomic number of iodine. Overall, this compound's unique structure positions it as a potentially valuable substance in pharmaceuticals and research applications.
Formula:C11H11I3N2O5
InChI:InChI=1S/C11H11I3N2O5/c12-6-4(10(19)16-1-3(18)2-17)7(13)9(15)8(14)5(6)11(20)21/h3,17-18H,1-2,15H2,(H,16,19)(H,20,21)
InChI key:InChIKey=URFBLIYCWAORDM-UHFFFAOYSA-N
SMILES:C(NCC(CO)O)(=O)C1=C(I)C(C(O)=O)=C(I)C(N)=C1I
Synonyms:- 3-Amino-5-[[(2,3-dihydroxypropyl)amino]carbonyl]-2,4,6-triiodobenzoic acid
- 5-Amino-N-(2,3-dihydroxypropyl)-2,4,6-triiodoisophthalamide acid
- Benzoic Acid, 3-Amino-5-[[(2,3-Dihydroxypropyl)Amino]Carbonyl]-2,4,6-Triiodo-
- 3-Amino-5-((2,3-dihydroxypropyl)carbamoyl)-2,4,6-triiodobenzoic acid
- 3-Amino-5-[(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Iopromide Impurity 1
CAS:Formula:C11H11I3N2O5Color and Shape:Pale Yellow SolidMolecular weight:631.93
