CAS 111466-41-2
:MK-912
Description:
MK-912, also known by its CAS number 111466-41-2, is a synthetic compound that belongs to the class of selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential applications in the treatment of various psychiatric disorders, particularly depression and anxiety. The compound exhibits a mechanism of action that involves the inhibition of serotonin reuptake, thereby increasing the availability of serotonin in the synaptic cleft, which can enhance mood and emotional well-being. MK-912 has been characterized by its moderate lipophilicity, which influences its pharmacokinetic properties, including absorption and distribution in biological systems. Additionally, it may exhibit a favorable safety profile, although specific toxicity and side effect data would depend on clinical studies. As with many investigational drugs, further research is necessary to fully understand its efficacy, optimal dosing, and long-term effects in human subjects.
Formula:C20H25N3O2
InChI:InChI=1/C20H25N3O2/c1-21-11-8-20(22(2)19(21)24)9-12-23-10-7-15-14-5-3-4-6-17(14)25-18(15)16(23)13-20/h3-6,16H,7-13H2,1-2H3
SMILES:CN1CCC2(CCN3CCc4c5ccccc5oc4C3C2)N(C)C1=O
Synonyms:- L 657743
- 1',3'-Dimethylspiro(1,3,4,5',6,6',7,12b-octahydro-2H-benzo(b)furo(2,3-a)quinolizine)-2,4'-pyrimidin-2'-one
- L-657,743-002W
- Spiro(2H-benzofuro(2,3-a)quinolizine-2,4'(1'H)-pyrimidin)-2'(3'H)-one, 1,3,4,5',6,6',7,12b-octahydro-1',3'-dimethyl-, (2S-trans)-
- 1',3'-dimethyl-1,3,4,5',6,6',7,12b-octahydro-1'H-spiro[1-benzofuro[2,3-a]quinolizine-2,4'-pyrimidin]-2'(3'H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mk-912 hydrochloride hydrate
CAS:MK-912 hydrochloride hydrate is a selective and potent antagonist of the α2-adrenoceptor, which is a type of biochemical compound used to study the sympathetic nervous system. Derived synthetically, its development stems from ongoing research into adrenergic receptors, primarily focusing on their role in neurotransmitter regulation. Its mode of action involves blocking the α2-adrenergic receptors, which leads to increased release of norepinephrine and other neurotransmitters, affecting heart rate and blood pressure, among other physiological parameters.Formula:C20H25N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:339.4 g/molL 657743
CAS:L 657743 is an Adrenergic alpha-Antagonist.Formula:C20H25N3O2Color and Shape:SolidMolecular weight:339.43


