CAS 111466-61-6
:[(1R)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate
Description:
The chemical substance with the name "[(1R)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate" and CAS number "111466-61-6" is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an amide and an ester, which contribute to its chemical reactivity and potential applications. The presence of a hexyl chain and a dodecyl group suggests that it may exhibit hydrophobic properties, making it suitable for use in formulations requiring surfactant or emulsifying characteristics. The oxetan moiety indicates a cyclic ether structure, which can influence the compound's stability and interaction with other molecules. Additionally, the stereochemistry indicated by the (R) and (S) designations suggests that the compound may exhibit specific biological activity or selectivity due to its three-dimensional arrangement. Overall, this substance's intricate structure and functional diversity may render it valuable in fields such as pharmaceuticals, agrochemicals, or materials science.
Formula:C29H53NO5
InChI:InChI=1/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m1/s1
SMILES:CCCCCCCCCCC[C@H](C[C@@H]1[C@@H](CCCCCC)C(=O)O1)OC(=O)[C@@H](CC(C)C)N=CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S,R,R,R)-Orlistat
CAS:Formula:C29H53NO5Color and Shape:White To Off-White SolidMolecular weight:495.75(S,R,R,R)-Orlistat
CAS:<p>Applications Orlistat isomer. Used in the asymmetric synthesis of Orlistat (O686500).<br>References Barbier, P., et al.: Helv. Chimica Acta, 70, 196 (1987),<br></p>Formula:C29H53NO5Color and Shape:NeatMolecular weight:495.73N-Formyl-L-leucine (1R)-1-[[(2R,3R)-3-Hexyl-4-oxo-2-oxetanyl]methyl]dodecyl ester
CAS:<p>N-Formyl-L-leucine (1R)-1-[[(2R,3R)-3-Hexyl-4-oxo-2-oxetanyl]methyl]dodecyl ester is an impurity standard for HPLC. It is a synthetic compound that has been custom synthesized to meet the requirements of a pharmacopoeia. This product is offered in a high purity and can be used for drug development and research and development.</p>Formula:C29H53NO5Purity:Min. 95%Molecular weight:495.73 g/mol



