CAS 111466-62-7: [(1S)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate
Description:The chemical substance with the name "[(1S)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate" and CAS number "111466-62-7" is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an oxetanone ring, a formamido group, and a long aliphatic dodecyl chain, which contribute to its amphiphilic nature. This amphiphilicity suggests potential applications in surfactants or emulsifiers, as the hydrophobic dodecyl chain can interact with nonpolar substances while the polar functional groups can interact with water. The stereochemistry indicated by the (1S) and (2R,3R) designations suggests that the compound has specific three-dimensional orientations, which can influence its biological activity and interactions with other molecules. Additionally, the presence of a ketone and amide functional groups may impart reactivity and solubility characteristics that are relevant in various chemical and biological contexts. Overall, this compound's structural complexity and functional diversity make it a subject of interest in fields such as medicinal chemistry and materials science.
Formula:C29H53NO5
InChI:InChI=1/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25+,26+,27+/m0/s1

(S,S,R,R)-Orlistat
Ref: 4Z-O-0187
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(S,S,R,R)-Orlistat
Ref: TR-O686490
1mg | 724.00 € | ||
2mg | 1,330.00 € | ||
250µg | 282.00 € |

N-Formyl-L-leucine (1S)-1-[[(2R,3R)-3-hexyl-4-oxo-2-oxetanyl] methyl] dodecyl ester
Ref: 3D-IF26581
1mg | 1,143.00 € | ||
2mg | 2,142.00 € | ||
5mg | 4,570.00 € |