CAS 111466-62-7
:[(1S)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate
Description:
The chemical substance with the name "[(1S)-1-[[(2R,3R)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate" and CAS number "111466-62-7" is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an oxetanone ring, a formamido group, and a long aliphatic dodecyl chain, which contribute to its amphiphilic nature. This amphiphilicity suggests potential applications in surfactants or emulsifiers, as the hydrophobic dodecyl chain can interact with nonpolar substances while the polar functional groups can interact with water. The stereochemistry indicated by the (1S) and (2R,3R) designations suggests that the compound has specific three-dimensional orientations, which can influence its biological activity and interactions with other molecules. Additionally, the presence of a ketone and amide functional groups may impart reactivity and solubility characteristics that are relevant in various chemical and biological contexts. Overall, this compound's structural complexity and functional diversity make it a subject of interest in fields such as medicinal chemistry and materials science.
Formula:C29H53NO5
InChI:InChI=1/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25+,26+,27+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S,S,R,R)-Orlistat
CAS:Applications Orlistat isomer. Used in the asymmetric synthesis of Orlistat (O686500).
References Barbier, P., et al.: Helv. Chimica Acta, 70, 196 (1987),Formula:C29H53NO5Color and Shape:NeatMolecular weight:495.73N-Formyl-L-leucine (1S)-1-[[(2R,3R)-3-hexyl-4-oxo-2-oxetanyl] methyl] dodecyl ester
CAS:N-Formyl-L-leucine (1S)-1-[[(2R,3R)-3-hexyl-4-oxo-2-oxetanyl] methyl] dodecyl ester is an impurity in the drug product. It can be used as a custom synthesis or natural standard and has been shown to have metabolites that are toxic to human cells. This impurity can be synthesized for HPLC analysis and research purposes.
Formula:C29H53NO5Purity:Min. 95%Molecular weight:495.73 g/mol



