CAS 111466-63-8
:[(1R)-1-[[(2S,3S)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate
Description:
The chemical substance with the name "[(1R)-1-[[(2S,3S)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2R)-2-formamido-4-methyl-pentanoate" and CAS number "111466-63-8" is a complex organic compound characterized by its unique structural features, including multiple chiral centers and functional groups. It contains a dodecyl chain, which contributes to its hydrophobic properties, and an oxetan-2-yl moiety that introduces a cyclic structure, enhancing its stability and reactivity. The presence of a formamido group indicates potential for hydrogen bonding, which may influence its solubility and interaction with biological systems. This compound may exhibit specific stereochemical configurations that can affect its biological activity, making it of interest in medicinal chemistry and drug design. Its intricate structure suggests potential applications in fields such as pharmaceuticals, where the balance of hydrophilicity and lipophilicity is crucial for drug efficacy and delivery. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C29H53NO5
InChI:InChI=1/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25+,26-,27+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(S,R,S,S)-Orlistat
CAS:Controlled Product<p>Applications Orlistat isomer. Used in the asymmetric synthesis of Orlistat (O686500).<br>References Barbier, P., et al.: Helv. Chimica Acta, 70, 196 (1987),<br></p>Formula:C29H53NO5Color and Shape:NeatMolecular weight:495.73


