CAS 111480-86-5
:1-ALLYL-1H-INDOLE-3-CARBALDEHYDE
Description:
1-Allyl-1H-indole-3-carbaldehyde, with the CAS number 111480-86-5, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an allyl group and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, while the indole moiety can participate in various chemical reactions, including electrophilic substitution. 1-Allyl-1H-indole-3-carbaldehyde may be utilized in the synthesis of more complex organic molecules and could have applications in pharmaceuticals, agrochemicals, or as a flavoring agent, depending on its specific properties and reactivity. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C12H11NO
InChI:InChI=1/C12H11NO/c1-2-7-13-8-10(9-14)11-5-3-4-6-12(11)13/h2-6,8-9H,1,7H2
SMILES:C=CCn1cc(C=O)c2ccccc12
Synonyms:- Asischem R39437
- 1-(prop-2-en-1-yl)-1H-indole-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.