CymitQuimica logo

CAS 1114809-24-3

:

5-Bromo-3-methyl-2-pyridinecarbonyl chloride

Description:
5-Bromo-3-methyl-2-pyridinecarbonyl chloride is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 3-position contributes to its unique reactivity and physical properties. The carbonyl chloride functional group, also known as an acyl chloride, is highly reactive, making this compound useful in various synthetic applications, particularly in the formation of amides and esters. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to its potential to release hydrochloric acid upon hydrolysis, which can be corrosive. Additionally, it may exhibit moderate to high toxicity, necessitating appropriate safety precautions during handling and storage. Overall, 5-Bromo-3-methyl-2-pyridinecarbonyl chloride serves as a valuable intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries.
Formula:C7H5BrClNO
InChI:InChI=1S/C7H5BrClNO/c1-4-2-5(8)3-10-6(4)7(9)11/h2-3H,1H3
InChI key:InChIKey=GYRYAHIYDINTAL-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(C)C=C(Br)C=N1
Synonyms:
  • 5-Bromo-3-methyl-2-pyridinecarbonyl chloride
  • 2-Pyridinecarbonyl chloride, 5-bromo-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.