CymitQuimica logo

CAS 1114822-66-0

:

1-(2-Fluoro-5-nitrophenyl)-1H-tetrazole

Description:
1-(2-Fluoro-5-nitrophenyl)-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of a 2-fluoro-5-nitrophenyl group indicates that the compound has both a fluorine atom and a nitro group attached to a phenyl ring, contributing to its unique chemical properties. This compound is typically used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. It may exhibit properties such as high thermal stability and reactivity, making it suitable for synthesis in organic chemistry. The presence of electron-withdrawing groups like the nitro and fluoro substituents can influence the compound's reactivity and solubility in different solvents. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may also exhibit interesting coordination chemistry with metal ions.
Formula:C7H4FN5O2
InChI:InChI=1S/C7H4FN5O2/c8-6-2-1-5(13(14)15)3-7(6)12-4-9-10-11-12/h1-4H
InChI key:InChIKey=PERUBVBZLRARSD-UHFFFAOYSA-N
SMILES:FC=1C(=CC(N(=O)=O)=CC1)N2C=NN=N2
Synonyms:
  • 1H-Tetrazole, 1-(2-fluoro-5-nitrophenyl)-
  • 1-(2-Fluoro-5-nitrophenyl)-1H-tetrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.