CymitQuimica logo

CAS 1114822-67-1

:

5,6-Dihydro-1,3-dimethylpyrano[3,4-b]pyrazolo[4,3-e]pyridin-8(1H)-one

Description:
5,6-Dihydro-1,3-dimethylpyrano[3,4-b]pyrazolo[4,3-e]pyridin-8(1H)-one is a heterocyclic compound characterized by its complex fused ring structure, which includes a pyrano and pyrazolo moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with various biological targets, possibly influencing pathways related to neuroprotection or anti-inflammatory effects. The presence of multiple functional groups, including the dimethyl and pyridinone components, contributes to its chemical reactivity and solubility properties. Additionally, the compound's stereochemistry may play a significant role in its pharmacological profile. As with many heterocycles, it may also exhibit unique spectroscopic characteristics, making it identifiable through techniques such as NMR and mass spectrometry. Overall, 5,6-Dihydro-1,3-dimethylpyrano[3,4-b]pyrazolo[4,3-e]pyridin-8(1H)-one represents a fascinating subject for further research in the fields of organic and medicinal chemistry.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c1-6-8-5-7-3-4-16-11(15)9(7)12-10(8)14(2)13-6/h5H,3-4H2,1-2H3
InChI key:InChIKey=DCXZXJXEFWACEC-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC3=C(N2)C(=O)OCC3)C(C)=N1
Synonyms:
  • 5,6-Dihydro-1,3-dimethylpyrano[3,4-b]pyrazolo[4,3-e]pyridin-8(1H)-one
  • Pyrano[3,4-b]pyrazolo[4,3-e]pyridin-8(1H)-one, 5,6-dihydro-1,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.