CymitQuimica logo

CAS 1114822-70-6

:

1,2,3,4-Tetrahydro-1,4-dimethyl-2-oxo-4-quinolinecarboxylic acid

Description:
1,2,3,4-Tetrahydro-1,4-dimethyl-2-oxo-4-quinolinecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of two methyl groups and a carboxylic acid functional group contributes to its chemical reactivity and potential biological activity. The oxo group (carbonyl) enhances its ability to participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its solubility, stability, and potential as a therapeutic agent. As with many organic compounds, its behavior in different environments, such as solvents or biological systems, can significantly influence its properties and applications.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-12(11(15)16)7-10(14)13(2)9-6-4-3-5-8(9)12/h3-6H,7H2,1-2H3,(H,15,16)
InChI key:InChIKey=DTFVOKBVVXNWCP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C)C=2C(N(C)C(=O)C1)=CC=CC2
Synonyms:
  • 4-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-1,4-dimethyl-2-oxo-
  • 1,2,3,4-Tetrahydro-1,4-dimethyl-2-oxo-4-quinolinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.