CAS 1114822-83-1

5-[(Acetylamino)methyl]-2-thiophenecarboxylic acid

Description:

5-[(Acetylamino)methyl]-2-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring, an acetylamino group, and a carboxylic acid functional group. The presence of the thiophene ring imparts aromatic properties, while the carboxylic acid group contributes to its acidity and potential for forming salts or esters. The acetylamino group enhances the compound's solubility in polar solvents and may influence its reactivity and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the functional groups present, which can participate in hydrogen bonding and other intermolecular forces. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 5-[(Acetylamino)methyl]-2-thiophenecarboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₈H₉NO₃S

InChI: InChI=1S/C8H9NO3S/c1-5(10)9-4-6-2-3-7(13-6)8(11)12/h2-3H,4H2,1H3,(H,9,10)(H,11,12)

InChI key: InChIKey=UVUOJWXMVIBWAX-UHFFFAOYSA-N

SMILES: C(NC(C)=O)C=1SC(C(O)=O)=CC1

Synonyms:

• 5-[(Acetylamino)methyl]-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 5-[(acetylamino)methyl]-