CAS 1114822-84-2

2-(2-Oxo-1-imidazolidinyl)-4-thiazoleacetic acid

Description:

2-(2-Oxo-1-imidazolidinyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include an imidazolidine ring and a thiazole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including acid-base reactions and nucleophilic substitutions. The presence of the thiazole ring suggests potential biological activity, as thiazole derivatives are often found in pharmaceuticals and agrochemicals. Additionally, the imidazolidinyl group may contribute to its stability and reactivity. The compound's molecular structure allows for various functional interactions, making it of interest in medicinal chemistry and material science. Its specific applications and biological activities would depend on further studies, including pharmacological assessments and synthetic modifications. Overall, 2-(2-Oxo-1-imidazolidinyl)-4-thiazoleacetic acid represents a versatile compound with potential implications in various fields of research.

Formula: C₈H₉N₃O₃S

InChI: InChI=1S/C8H9N3O3S/c12-6(13)3-5-4-15-8(10-5)11-2-1-9-7(11)14/h4H,1-3H2,(H,9,14)(H,12,13)

InChI key: InChIKey=MIYBAXVWACBFPY-UHFFFAOYSA-N

SMILES: O=C1N(C2=NC(CC(O)=O)=CS2)CCN1

Synonyms:

• 2-[2-(2-Oxoimidazolidin-1-yl)-1,3-thiazol-4-yl]acetic acid
• 4-Thiazoleacetic acid, 2-(2-oxo-1-imidazolidinyl)-
• 2-(2-Oxo-1-imidazolidinyl)-4-thiazoleacetic acid
• 2-[2-(2-Oxoimidazolidin-1-yl)thiazol-4-yl]acetic acid