CymitQuimica logo

CAS 1114823-57-2

:

4-Amino-1-(3-chlorophenyl)-2-pyrrolidinone

Description:
4-Amino-1-(3-chlorophenyl)-2-pyrrolidinone, with the CAS number 1114823-57-2, is a chemical compound characterized by its pyrrolidinone structure, which features a pyrrolidine ring substituted with an amino group and a chlorophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. The chlorophenyl moiety may impart specific electronic and steric properties, influencing its reactivity and interactions with biological targets. As an amine, it can participate in hydrogen bonding, which may enhance its solubility and reactivity in various chemical environments. The presence of the chlorine atom can also affect the compound's lipophilicity and biological activity. Overall, 4-Amino-1-(3-chlorophenyl)-2-pyrrolidinone may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological systems. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C10H11ClN2O
InChI:InChI=1S/C10H11ClN2O/c11-7-2-1-3-9(4-7)13-6-8(12)5-10(13)14/h1-4,8H,5-6,12H2
InChI key:InChIKey=USPVRBVWGQTTLY-UHFFFAOYSA-N
SMILES:O=C1N(C2=CC(Cl)=CC=C2)CC(N)C1
Synonyms:
  • 4-Amino-1-(3-chlorophenyl)-2-pyrrolidinone
  • 2-Pyrrolidinone, 4-amino-1-(3-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.