CAS 1114823-88-9

5-(2-Chloroacetyl)-2,3-dihydro-1H-indole-1-carboxaldehyde

Description:

5-(2-Chloroacetyl)-2,3-dihydro-1H-indole-1-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a chloroacetyl group and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloroacetyl moiety suggests that it may participate in nucleophilic substitution reactions, while the aldehyde group can undergo oxidation or condensation reactions. The compound's molecular structure indicates it may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, its unique functional groups can facilitate interactions with various biological targets. As with many indole derivatives, it may also display properties such as fluorescence or photochemical reactivity. Safety and handling precautions should be observed due to the presence of chlorine and reactive functional groups, which may pose health risks. Overall, this compound represents a versatile building block in the synthesis of more complex organic molecules.

Formula: C₁₁H₁₀ClNO₂

InChI: InChI=1S/C11H10ClNO2/c12-6-11(15)9-1-2-10-8(5-9)3-4-13(10)7-14/h1-2,5,7H,3-4,6H2

InChI key: InChIKey=LLCRAYZJRHFGOQ-UHFFFAOYSA-N

SMILES: C(=O)N1C=2C(=CC(C(CCl)=O)=CC2)CC1

Synonyms:

• 5-(2-Chloroacetyl)-2,3-dihydro-1H-indole-1-carboxaldehyde
• 1H-Indole-1-carboxaldehyde, 5-(2-chloroacetyl)-2,3-dihydro-