CAS 1114823-91-4
:5-(4-Aminophenyl)-8,9-dihydro-2H-pyridazino[4,5-a]pyrrolizine-1,4(3H,7H)-dione
Description:
5-(4-Aminophenyl)-8,9-dihydro-2H-pyridazino[4,5-a]pyrrolizine-1,4(3H,7H)-dione, with the CAS number 1114823-91-4, is a chemical compound characterized by its complex bicyclic structure, which includes a pyridazine and pyrrolizine moiety. This compound features an amino group attached to a phenyl ring, contributing to its potential reactivity and biological activity. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its molecular interactions may be influenced by the presence of substituents on the aromatic ring, which can affect its pharmacokinetic properties. Overall, this compound represents a class of heterocyclic compounds that may exhibit interesting biological activities worthy of further investigation.
Formula:C15H14N4O2
InChI:InChI=1S/C15H14N4O2/c16-9-5-3-8(4-6-9)13-12-11(10-2-1-7-19(10)13)14(20)17-18-15(12)21/h3-6H,1-2,7,16H2,(H,17,20)(H,18,21)
InChI key:InChIKey=YIAMHEGBHVCAIW-UHFFFAOYSA-N
SMILES:O=C1C2=C(N3C(=C2C(=O)NN1)CCC3)C4=CC=C(N)C=C4
Synonyms:- 2H-Pyridazino[4,5-a]pyrrolizine-1,4(3H,7H)-dione, 5-(4-aminophenyl)-8,9-dihydro-
- 5-(4-Aminophenyl)-8,9-dihydro-2H-pyridazino[4,5-a]pyrrolizine-1,4(3H,7H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.