CAS 1114823-93-6
:5-(Chlorosulfonyl)-3-methyl-2-thiophenecarboxylic acid
Description:
5-(Chlorosulfonyl)-3-methyl-2-thiophenecarboxylic acid is a chemical compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a chlorosulfonyl group, which is a strong electrophile, making it reactive in various chemical transformations. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The methyl group at the 3-position of the thiophene ring influences the compound's steric and electronic properties, potentially affecting its reactivity and solubility. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that allow for further chemical modifications. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of the chlorosulfonyl group, which can be hazardous.
Formula:C6H5ClO4S2
InChI:InChI=1S/C6H5ClO4S2/c1-3-2-4(13(7,10)11)12-5(3)6(8)9/h2H,1H3,(H,8,9)
InChI key:InChIKey=BCZVCWODZXDDOE-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(C(O)=O)=C(C)C1
Synonyms:- 2-Thiophenecarboxylic acid, 5-(chlorosulfonyl)-3-methyl-
- 5-(Chlorosulfonyl)-3-methyl-2-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Chlorosulfonyl)-3-methylthiophene-2-carboxylic Acid
CAS:Controlled ProductStability Moisture Sensitive
Applications 5-(chlorosulfonyl)-3-methylthiophene-2-carboxylic acid (cas# 1114823-93-6) is a useful research chemical.Formula:C6H5O4S2ClColor and Shape:NeatMolecular weight:240.68
