CAS 1114823-97-0
:Methyl 3-[(chlorosulfonyl)methyl]-2-furancarboxylate
Description:
Methyl 3-[(chlorosulfonyl)methyl]-2-furancarboxylate is a chemical compound characterized by its unique structure, which includes a furan ring, a carboxylate group, and a chlorosulfonyl functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the chlorosulfonyl group, which can participate in various nucleophilic substitution reactions. The furan ring contributes to its aromatic properties, making it a potential candidate for further chemical modifications. Methyl 3-[(chlorosulfonyl)methyl]-2-furancarboxylate may be used in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Safety considerations are important when handling this compound, as it may be corrosive and harmful upon exposure. Proper storage and handling protocols should be followed to mitigate risks associated with its chemical reactivity and potential toxicity.
Formula:C7H7ClO5S
InChI:InChI=1S/C7H7ClO5S/c1-12-7(9)6-5(2-3-13-6)4-14(8,10)11/h2-3H,4H2,1H3
InChI key:InChIKey=WZPCMSYQBCVOCG-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C1=C(C(OC)=O)OC=C1
Synonyms:- 2-Furancarboxylic acid, 3-[(chlorosulfonyl)methyl]-, methyl ester
- Methyl 3-[(chlorosulfonyl)methyl]-2-furancarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.