
CAS 111492-69-4
:1-(Phenylmethyl)-2,3-piperidinedione
Description:
1-(Phenylmethyl)-2,3-piperidinedione, also known by its CAS number 111492-69-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenylmethyl group, indicating the presence of a benzene ring attached to a methylene (-CH2-) group, which contributes to its aromatic properties. The two carbonyl groups (C=O) in the 2 and 3 positions of the piperidine ring are responsible for its diketone functionality, influencing its reactivity and potential applications in organic synthesis. The presence of these functional groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the compound's structural characteristics may impart specific biological activities, making it of interest in medicinal chemistry. Its solubility, stability, and interaction with other substances would depend on the solvent and environmental conditions, which are critical for its practical applications in research and industry.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c14-11-7-4-8-13(12(11)15)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2
InChI key:InChIKey=YXCASZOHZLUBIF-UHFFFAOYSA-N
SMILES:C(N1C(=O)C(=O)CCC1)C2=CC=CC=C2
Synonyms:- 1-Benzyl-2,3-piperidinedione
- 2,3-Piperidinedione, 1-(phenylmethyl)-
- 1-(Phenylmethyl)-2,3-piperidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.