
CAS 1115-08-8
:3-Methyl-1,4-pentadiene
Description:
3-Methyl-1,4-pentadiene, also known as isoprene, is a colorless liquid hydrocarbon with the molecular formula C5H8. It is classified as a diene due to the presence of two double bonds in its structure. This compound is characterized by its high reactivity, particularly in polymerization reactions, making it a key monomer in the production of synthetic rubber, such as polyisoprene. 3-Methyl-1,4-pentadiene has a boiling point that allows it to exist as a gas at room temperature, and it has a relatively low density compared to water. The compound is flammable and poses health risks upon inhalation or skin contact, necessitating proper safety precautions during handling. Additionally, it has a distinct odor, which can be described as sweet or similar to that of natural rubber. Its reactivity and physical properties make it an important substance in both industrial applications and organic synthesis.
Formula:C6H10
InChI:InChI=1S/C6H10/c1-4-6(3)5-2/h4-6H,1-2H2,3H3
InChI key:InChIKey=IKQUUYYDRTYXAP-UHFFFAOYSA-N
SMILES:C(C=C)(C=C)C
Synonyms:- 3-Methyl-1,4-pentadiene
- 1,4-Pentadiene, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
