CAS 1115-65-7
:L-Cysteinesulfinic acid
Description:
L-Cysteinesulfinic acid, with the CAS number 1115-65-7, is a naturally occurring amino acid derivative that plays a role in the metabolism of sulfur-containing compounds. It is characterized by the presence of a sulfinic acid group (-SO2H) attached to the cysteine backbone, which distinguishes it from other amino acids. This compound is typically found in biological systems and is involved in the synthesis of taurine and other important biomolecules. L-Cysteinesulfinic acid is soluble in water, reflecting its polar nature due to the presence of both amino and sulfinic acid functional groups. It exhibits a zwitterionic form at physiological pH, which contributes to its reactivity and interactions in biochemical pathways. Additionally, it can act as an antioxidant, participating in redox reactions that protect cells from oxidative stress. Its role in various metabolic processes makes it significant in both nutrition and biochemistry, particularly in the context of sulfur metabolism and amino acid biosynthesis.
Formula:C3H7NO4S
InChI:InChI=1S/C3H7NO4S/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/t2-/m0/s1
InChI key:InChIKey=ADVPTQAUNPRNPO-REOHCLBHSA-N
SMILES:[C@H](CS(=O)O)(C(O)=O)N
Synonyms:- (2R)-2-Amino-3-sulfinopropanoic acid
- (2R)-2-ammonio-3-sulfinatopropanoate
- 3-Sulfino-<span class="text-smallcaps">L</span>-alanine
- 3-Sulfinoalanine
- 3-sulfino-L-alanine
- 3-sulphino-L-alanine
- <span class="text-smallcaps">L</span>-2-Amino-3-sulfinopropionic acid
- <span class="text-smallcaps">L</span>-Alanine, 3-sulfino-
- <span class="text-smallcaps">L</span>-Cysteinesulfinic acid
- Alanine, 3-sulfino-, <span class="text-smallcaps">L</span>-
- Cysteinesulfinic acid
- L-cysteine sulphinic acid
- L-2-Amino-3-sulfinopropionic acid
- Alanine, 3-sulfino-, L-
- L-Alanine, 3-sulfino-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
L-Cysteinesulfinic acid
CAS:Formula:C3H7NO4SColor and Shape:White To Off-White SolidMolecular weight:153.15L-Cysteinesulfinic Acid
CAS:Controlled ProductFormula:C3H7NO4SColor and Shape:NeatMolecular weight:153.16L-Cysteinesulfinic acid
CAS:<p>L-Cysteinesulfinic acid is agonistic on metabotropic glutamate receptors (mGluRs), including mGluR1, mGluR5, mGluR2, mGluR4, mGluR6, and mGluR8,.</p>Formula:C3H7NO4SPurity:99.96%Color and Shape:SolidMolecular weight:153.16L-Cysteinesulfinic acid
CAS:<p>L-Cysteine sulfinic acid is an enzyme that catalyzes the hydrolysis of taurine to produce cysteine, which is essential for the synthesis of proteins. It also has a number of other functions, including detoxification and antioxidant activity. L-Cysteine sulfinic acid has been shown to have antiviral properties in a model system using human cells infected with HIV. The enzyme is also active against oxidative injury caused by reactive oxygen species (ROS) and metal chelate toxicity. L-Cysteine sulfinic acid can be used as a biochemical marker for the presence of infectious diseases due to its high specificity for these types of pathogens. This enzyme can also be used as an analytical tool to determine the presence of sephadex g-100 in blood samples, which are usually used for diagnostic purposes.</p>Formula:C3H7NO4SPurity:Min. 95%Molecular weight:153.16 g/mol






