CAS 111504-19-9
:cyclohexyl(2-methoxyphenyl)methanone
Description:
Cyclohexyl(2-methoxyphenyl)methanone, identified by its CAS number 111504-19-9, is an organic compound characterized by its ketone functional group. It features a cyclohexyl group and a 2-methoxyphenyl moiety, which contribute to its structural complexity and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is relatively non-polar due to the presence of the cyclohexyl and aromatic rings, which may influence its solubility in organic solvents. The methoxy group enhances its electron-donating properties, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Cyclohexyl(2-methoxyphenyl)methanone may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health hazards.
Formula:C14H18O2
InChI:InChI=1/C14H18O2/c1-16-13-10-6-5-9-12(13)14(15)11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3
SMILES:COc1ccccc1C(=O)C1CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.