CAS 111509-09-2
:lepedine
Description:
Lepidine, with the CAS number 111509-09-2, is a chemical compound that belongs to the class of heterocyclic organic compounds. It is characterized by the presence of a nitrogen atom within a six-membered ring structure, which contributes to its basicity and potential reactivity. Lepidine is often studied for its applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals. Its molecular structure allows for interactions with biological systems, making it of interest in drug development. The compound may exhibit properties such as solubility in organic solvents and varying degrees of stability under different conditions. Additionally, lepidine's derivatives can possess diverse biological activities, which further enhances its significance in research. Safety and handling precautions should be observed due to its chemical nature, as with many nitrogen-containing heterocycles. Overall, lepidine serves as an important compound in the field of organic chemistry and pharmacology.
Formula:C23H35NO3
InChI:InChI=1/C23H35NO3/c1-5-24-11-21(3)8-7-16(27-4)23-15(21)10-14(19(23)24)22-9-6-13(12(2)20(22)26)17(25)18(22)23/h13-20,25-26H,2,5-11H2,1,3-4H3/t13-,14+,15-,16-,17-,18+,19+,20+,21?,22?,23?/m0/s1
Synonyms:- 7,20-Cycloatidane-11,15-diol, 16,17-didehydro-21-ethyl-1-methoxy-4-methyl-, (1alpha,11beta,15beta)-
- (1alpha,5alpha,7beta,11beta,12beta,15beta,20R)-21-ethyl-1-methoxy-4-methyl-7,20-cycloatid-16-ene-11,15-diol
- Lepedine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lepedine
CAS:<p>Lepedine is a diterpenoid alkaloid extracted from the root of Aconitum psedohuiliense.</p>Formula:C23H35NO3Color and Shape:SolidMolecular weight:373.537
