CAS 111510-96-4
:2-BUTYL-5-METHYLTHIOPHENE
Description:
2-Butyl-5-methylthiophene is an organic compound belonging to the class of thiophenes, which are five-membered aromatic heterocycles containing sulfur. This particular compound features a butyl group and a methylthio group attached to the thiophene ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the butyl group enhances its hydrophobic characteristics, while the methylthio group can influence its reactivity and solubility in various solvents. 2-Butyl-5-methylthiophene is of interest in organic synthesis and may be utilized in the production of various chemical intermediates or as a building block in the synthesis of more complex molecules. Its chemical behavior is influenced by the electron-donating and withdrawing effects of the substituents on the thiophene ring, which can affect its reactivity in electrophilic and nucleophilic reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H14S
InChI:InChI=1/C9H14S/c1-3-4-5-9-7-6-8(2)10-9/h6-7H,3-5H2,1-2H3
SMILES:CCCCc1ccc(C)s1
Synonyms:- 2-N-Butyl-5-Methylthiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

