
CAS 111511-91-2: 4H-Pyran-4,4-dimethanamine, tetrahydro-, hydrochloride (1:2)
Description:4H-Pyran-4,4-dimethanamine, tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a tetrahydro configuration, indicating that it is fully saturated with hydrogen, contributing to its stability and reactivity. The presence of dimethanamine suggests that there are two methyl groups attached to the amine, which can influence its basicity and solubility in various solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it useful in various applications, including pharmaceuticals and organic synthesis. The compound's specific properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the presence of functional groups. Overall, this compound is of interest in medicinal chemistry and may exhibit biological activity due to its structural features.
Formula:C7H16N2O·2ClH
InChI:InChI=1S/C7H16N2O.2ClH/c8-5-7(6-9)1-3-10-4-2-7;;/h1-6,8-9H2;2*1H
InChI key:InChIKey=VYHCYRMBGZAUPN-UHFFFAOYSA-N
SMILES:Cl.O1CCC(CN)(CN)CC1
- Synonyms:
- (Tetrahydro-2H-pyran-4,4-diyl)dimethanamine dihydrochloride
- 4H-Pyran-4,4-dimethanamine, tetrahydro-, hydrochloride (1:2)
- [4-(Aminomethyl)oxan-4-yl]methanamine dihydrochloride
- 4H-Pyran-4,4-dimethanamine, tetrahydro-, dihydrochloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [4-(Aminomethyl)oxan-4-yl]methanamine dihydrochloride REF: 3D-LEA51191CAS: 111511-91-2 | Min. 95% | To inquire | Tue 10 Jun 25 |

[4-(Aminomethyl)oxan-4-yl]methanamine dihydrochloride
Ref: 3D-LEA51191
50mg | 731.00 € | ||
500mg | 2,111.00 € |