CAS 111525-02-1
:N-(1-NAPHTHALEN-2-YL-ETHYL)-HYDROXYLAMINE
Description:
N-(1-Naphthalen-2-yl-ethyl)-hydroxylamine, with the CAS number 111525-02-1, is an organic compound characterized by the presence of a hydroxylamine functional group attached to a naphthalene derivative. This compound features a naphthalene ring, which contributes to its aromatic properties, and an ethyl group that enhances its hydrophobic characteristics. Hydroxylamines are known for their reactivity, particularly in redox reactions, and can act as reducing agents or nucleophiles. The presence of the naphthalene moiety may impart additional stability and influence the compound's solubility and interaction with other substances. Typically, compounds like this can be utilized in organic synthesis, pharmaceuticals, or as intermediates in various chemical reactions. However, specific safety and handling guidelines should be followed, as hydroxylamines can be sensitive to oxidation and may pose risks if not managed properly. Overall, N-(1-naphthalen-2-yl-ethyl)-hydroxylamine represents a unique structure with potential applications in chemical research and development.
Formula:C12H13NO
InChI:InChI=1/C12H13NO/c1-9(13-14)11-7-6-10-4-2-3-5-12(10)8-11/h2-9,13-14H,1H3
SMILES:CC(c1ccc2ccccc2c1)NO
Synonyms:- 2-[1-(Hydroxyamino)ethyl]naphthalen
- 2-naphthalenemethanamine, N-hydroxy-α-methyl-
- N-Hydroxy-1-(2-naphthyl)ethanamine
- N-[1-(2-naphthyl)ethyl]hydroxylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.