CAS 111540-02-4
:1-but-3-enyl-3,5-dimethoxy-benzene
Description:
1-But-3-enyl-3,5-dimethoxy-benzene, identified by its CAS number 111540-02-4, is an organic compound that features a benzene ring substituted with two methoxy groups and a butenyl side chain. The presence of the methoxy groups at the 3 and 5 positions of the benzene ring contributes to its electron-donating properties, which can enhance its reactivity in electrophilic aromatic substitution reactions. The butenyl group introduces unsaturation, making the compound potentially reactive in addition reactions. This compound is likely to exhibit characteristics typical of aromatic compounds, such as stability due to resonance, while also displaying the reactivity associated with alkenes. Its structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules or as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, the presence of methoxy groups may influence its solubility and polarity, affecting its behavior in various chemical environments. Overall, 1-but-3-enyl-3,5-dimethoxy-benzene is a versatile compound with interesting chemical properties.
Formula:C12H16O2
InChI:InChI=1/C12H16O2/c1-4-5-6-10-7-11(13-2)9-12(8-10)14-3/h4,7-9H,1,5-6H2,2-3H3
SMILES:C=CCCc1cc(cc(c1)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.