CymitQuimica logo

CAS 1115490-85-1

:

BenzenaMine, 3-fluoro-4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)-

Description:
BenzenaMine, 3-fluoro-4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)-, identified by its CAS number 1115490-85-1, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a fluorine atom and a pyrazolo-pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The fluorine substitution can enhance lipophilicity and influence the compound's biological activity, making it of interest in medicinal chemistry. The presence of the pyrazolo[3,4-b]pyridine structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C12H9FN4O
InChI:InChI=1S/C12H9FN4O/c13-9-5-7(14)1-2-11(9)18-10-3-4-15-12-8(10)6-16-17-12/h1-6H,14H2,(H,15,16,17)
InChI key:KFEHQSLGLJKXMG-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1N)F)OC2=C3C=NNC3=NC=C2
Synonyms:
  • 3-Fluoro-4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)benzenamine
Found 3 products.