CymitQuimica logo

CAS 111550-48-2

:

1,10-Bis(4-formylphenyl)-1,4,7,10-tetraoxadecane

Description:
1,10-Bis(4-formylphenyl)-1,4,7,10-tetraoxadecane, identified by its CAS number 111550-48-2, is an organic compound characterized by its unique structure, which includes a long aliphatic chain and multiple functional groups. This compound features two aldehyde groups (formyl) attached to phenyl rings, which can participate in various chemical reactions, including condensation and polymerization. The tetraoxadecane backbone consists of alternating carbon and oxygen atoms, contributing to its potential solubility in polar solvents and influencing its physical properties. The presence of the formyl groups allows for reactivity that can be exploited in synthetic applications, such as in the formation of polymers or as intermediates in organic synthesis. Additionally, the compound may exhibit interesting optical properties due to the conjugated system formed by the phenyl rings, making it potentially useful in materials science and organic electronics. Overall, its structural features suggest versatility in chemical reactivity and potential applications in various fields, including materials chemistry and organic synthesis.
Formula:C20H22O6
InChI:InChI=1S/C20H22O6/c21-15-17-1-5-19(6-2-17)25-13-11-23-9-10-24-12-14-26-20-7-3-18(16-22)4-8-20/h1-8,15-16H,9-14H2
InChI key:InChIKey=SJNNZXIPFSRUJB-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOC1=CC=C(C=O)C=C1)C2=CC=C(C=O)C=C2
Synonyms:
  • Benzaldehyde, 4,4′-[1,2-ethanediylbis(oxy-2,1-ethanediyloxy)]bis-
  • 1,10-Bis(4-formylphenyl)-1,4,7,10-tetraoxadecane
  • 4,4′-[1,2-Ethanediylbis(oxy-2,1-ethanediyloxy)]bis[benzaldehyde]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.