CAS 111573-53-6

6H-Pyrrolo[1,2-b]pyrazol-6-one

Description:

6H-Pyrrolo[1,2-b]pyrazol-6-one, identified by its CAS number 111573-53-6, is a heterocyclic organic compound featuring a fused pyrrole and pyrazole ring system. This compound is characterized by its unique bicyclic structure, which contributes to its potential biological activity and chemical reactivity. It typically exhibits a solid state at room temperature and may possess various functional groups that influence its solubility and interaction with other molecules. The presence of nitrogen atoms in its structure can impart basic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds of this type are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The stability and reactivity of 6H-Pyrrolo[1,2-b]pyrazol-6-one can be influenced by substituents on the ring, which can modulate its electronic properties and biological activity. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its structural features and potential applications.

Formula: C₆H₄N₂O

InChI: InChI=1S/C6H4N2O/c9-6-2-1-5-3-4-7-8(5)6/h1-4H

InChI key: InChIKey=PBOBBKBQQFLGDJ-UHFFFAOYSA-N

SMILES: O=C1N2C(=CC=N2)C=C1

Synonyms:

• 6H-Pyrrolo[1,2-b]pyrazol-6-one