CAS 111573-59-2

3-(dimethoxymethyl)-1H-pyrazole

Description:

3-(Dimethoxymethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a dimethoxymethyl substituent, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity, making it a versatile intermediate in organic synthesis. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its molecular structure allows for various functionalization reactions, which can lead to the development of novel compounds with specific applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-(dimethoxymethyl)-1H-pyrazole exemplifies the diverse chemistry associated with pyrazole derivatives.

Formula: C₆H₁₀N₂O₂

InChI: InChI=1/C6H10N2O2/c1-9-6(10-2)5-3-4-7-8-5/h3-4,6H,1-2H3,(H,7,8)

SMILES: COC(c1cc[nH]n1)OC

Synonyms:

• 5-(dimethoxymethyl)-1H-pyrazole

3-(Dimethoxymethyl)-1H-pyrazole

CAS: 111573-59-2

Formula: C₆H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1558

Ref: IN-DA008SH0

3-(Dimethoxymethyl)-1H-pyrazole

CAS: 111573-59-2

3-(Dimethoxymethyl)-1H-pyrazole

Purity: ≥95%

Molecular weight: 142.16g/mol

Ref: 54-OR27386

3-(Dimethoxymethyl)-1H-pyrazole

CAS: 111573-59-2

Formula: C₆H₁₀N₂O₂

Purity: 97%

Molecular weight: 142.158

Ref: 10-F329594

3-(Dimethoxymethyl)-1H-pyrazole

CAS: 111573-59-2

3-(Dimethoxymethyl)-1H-pyrazole is a natural product that is produced by the reaction of acetals with catalytic amounts of trifluoromethanesulfonic acid. This chemical is synthesised by reacting orthoformates and functional groups. 3-(Dimethoxymethyl)-1H-pyrazole is found in catalytic amounts in the synthesis of pyrazoles and cyclic compounds. The yield of 3-(dimethoxymethyl)-1H-pyrazole can be increased by adding an oxidant to the reaction mixture.

Formula: C₆H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 142.16 g/mol

Ref: 3D-LEA57359