CAS 111574-81-3
:7-glutaryl-phenylalaninamide-4-trifluoromethyl-2-quinolinone
Description:
7-Glutaryl-phenylalaninamide-4-trifluoromethyl-2-quinolinone, with the CAS number 111574-81-3, is a synthetic organic compound that belongs to the class of quinolinones, which are known for their diverse biological activities. This compound features a quinolinone core, which is characterized by a fused benzene and pyridine ring structure, along with a trifluoromethyl group that enhances its lipophilicity and potentially its biological activity. The presence of the glutaryl and phenylalanine moieties suggests that it may interact with biological systems, possibly serving as a pharmacophore in drug design. Its unique structure may confer specific properties such as solubility, stability, and reactivity, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group is often associated with increased metabolic stability and altered pharmacokinetics. Overall, this compound's characteristics make it a candidate for further investigation in the context of therapeutic applications, although specific biological activities and mechanisms would require empirical studies for validation.
Formula:C24H22F3N3O5
InChI:InChI=1/C24H22F3N3O5/c25-24(26,27)17-13-21(32)29-18-12-15(9-10-16(17)18)28-23(35)19(11-14-5-2-1-3-6-14)30-20(31)7-4-8-22(33)34/h1-3,5-6,9-10,12-13,19H,4,7-8,11H2,(H,28,35)(H,29,32)(H,30,31)(H,33,34)/t19-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C(=Nc1ccc2c(cc(nc2c1)O)C(F)(F)F)O)N=C(CCCC(=O)O)O
Synonyms:- Glt-phe-Nh-fmeq
- 5-oxo-5-{[(2S)-1-oxo-1-{[2-oxo-4-(trifluoromethyl)-1,2-dihydroquinolin-7-yl]amino}-3-phenylpropan-2-yl]amino}pentanoic acid
- 7-Glutaryl-phenylalaninamide-4-trifluoromethyl-2-quinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.