CAS 111574-82-4

7-glutaryl-leucyl-phenylalaninamide-4-trifluoromethyl-2-quinolinone

Description:

7-Glutaryl-leucyl-phenylalaninamide-4-trifluoromethyl-2-quinolinone, with the CAS number 111574-82-4, is a synthetic organic compound characterized by its complex structure, which includes a quinolinone core and various functional groups. This compound typically exhibits properties associated with both amides and quinolinones, such as potential biological activity and solubility in organic solvents. The presence of the trifluoromethyl group may enhance lipophilicity and influence its pharmacokinetic properties. Additionally, the glutaryl and leucyl moieties suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific applications may vary, but compounds of this nature are often explored for their roles in drug development, particularly in the context of targeting specific enzymes or receptors. As with many synthetic compounds, its stability, reactivity, and interaction with other molecules would depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₃₀H₃₃F₃N₄O₆

InChI: InChI=1/C30H33F3N4O6/c1-17(2)13-23(36-25(38)9-6-10-27(40)41)28(42)37-29(43)24(14-18-7-4-3-5-8-18)34-19-11-12-20-21(30(31,32)33)16-26(39)35-22(20)15-19/h3-5,7-8,11-12,15-17,23-24,34H,6,9-10,13-14H2,1-2H3,(H,35,39)(H,36,38)(H,40,41)(H,37,42,43)/t23-,24-/m0/s1

SMILES: CC(C)C[C@@H](C(=NC(=O)[C@H](Cc1ccccc1)Nc1ccc2c(cc(nc2c1)O)C(F)(F)F)O)N=C(CCCC(=O)O)O

Synonyms:

• Glt-leu-phe-NH-fmeq
• 5-{[(2S)-4-methyl-1-oxo-1-({N-[2-oxo-4-(trifluoromethyl)-1,2-dihydroquinolin-7-yl]-L-phenylalanyl}amino)pentan-2-yl]amino}-5-oxopentanoic acid
• 7-Glutaryl-leucyl-phenylalaninamide-4-trifluoromethyl-2-quinolinone