CAS 111574-85-7
:S-(1,2,2-trichlorovinyl)glutathione
Description:
S-(1,2,2-Trichlorovinyl)glutathione is a synthetic organosulfur compound that is a derivative of glutathione, a tripeptide composed of glutamate, cysteine, and glycine. This compound is characterized by the presence of a trichlorovinyl group, which contributes to its reactivity and potential biological activity. It is known for its role in the detoxification of certain environmental pollutants and may interact with various biological systems, particularly in the context of cellular defense mechanisms against oxidative stress. The presence of chlorine atoms in its structure can influence its stability, solubility, and reactivity, making it a subject of interest in toxicology and environmental chemistry. Additionally, S-(1,2,2-trichlorovinyl)glutathione has been studied for its potential implications in the metabolism of chlorinated compounds and its effects on cellular processes. As with many organochlorine compounds, understanding its behavior in biological systems is crucial for assessing its environmental impact and potential health risks.
Formula:C12H16Cl3N3O6S
InChI:InChI=1/C12H16Cl3N3O6S/c13-9(14)10(15)25-4-6(11(22)17-3-8(20)21)18-7(19)2-1-5(16)12(23)24/h5-6H,1-4,16H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)/t5-,6?/m0/s1
SMILES:C(CC(=NC(CSC(=C(Cl)Cl)Cl)C(=NCC(=O)O)O)O)[C@@H](C(=O)O)N
Synonyms:- Ccris 3854
- N-(N-L-gamma-Glutamyl-S-(trichloroethenyl)-L-cysteinyl)glycine
- Tcvg
- Glycine, N-(N-L-gamma-glutamyl-S-(trichloroethenyl)-L-cysteinyl)-
- L-gamma-glutamyl-S-(trichloroethenyl)cysteinylglycine
- S-(1,2,2-Trichlorovinyl)glutathione
- Glycine, L-γ-glutamyl-S-(1,2,2-trichloroethenyl)-L-cysteinyl-
- L-γ-Glutamyl-S-(trichlorovinyl)cysteinylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
