CAS 111581-52-3

fluorovinylglycine

Description:

Fluorovinylglycine, with the CAS number 111581-52-3, is an organic compound characterized by the presence of both a vinyl group and an amino acid structure. It features a fluorine atom attached to the vinyl group, which contributes to its unique chemical properties. This compound is typically classified as an amino acid derivative, and its structure includes a carboxylic acid functional group, an amine group, and a vinyl group, making it a potential candidate for various biochemical applications. Fluorovinylglycine may exhibit interesting reactivity due to the presence of the fluorine atom, which can influence its interaction with biological systems and other chemical entities. Additionally, the vinyl group may allow for further polymerization or reaction with other compounds, making it useful in synthetic chemistry. Its potential applications could span from pharmaceuticals to agrochemicals, depending on its biological activity and stability. As with many fluorinated compounds, it may also exhibit unique properties such as increased lipophilicity or altered metabolic pathways.

Formula: C₄H₆FNO₂

InChI: InChI=1/C4H6FNO2/c1-2(5)3(6)4(7)8/h3H,1,6H2,(H,7,8)

SMILES: C=C(C(C(=O)O)N)F

Synonyms:

• 2-Amino-3-fluoro-3-butenoic acid
• 3-Fluorovinylglycine
• FVGly
• 3-Butenoic acid, 2-amino-3-fluoro-, (+-)-
• 2-Amino-3-Fluorobut-3-Enoic Acid