CymitQuimica logo

CAS 111581-91-0

:

diphenylmethyl (4S,7S,12bR)-7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,6,7,8,12b-octahydropyrido[2,1-a][2]benzazepine-4-carboxylate

Description:
Diphenylmethyl (4S,7S,12bR)-7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,6,7,8,12b-octahydropyrido[2,1-a][2]benzazepine-4-carboxylate, with CAS number 111581-91-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple rings and functional groups. This substance features a pyrido-benzazepine core, indicative of its potential biological activity, particularly in medicinal chemistry. The presence of an ethoxy group and a carboxylate moiety suggests it may exhibit solubility in organic solvents and could participate in various chemical reactions. Its stereochemistry, denoted by the specific configuration at several chiral centers, may influence its pharmacological properties and interactions with biological targets. The compound's potential applications could span across therapeutic areas, particularly in drug development, owing to its unique structural features. However, detailed studies would be necessary to fully elucidate its properties, including stability, reactivity, and biological efficacy.
Formula:C40H42N2O5
InChI:InChI=1/C40H42N2O5/c1-2-46-39(44)33(26-25-28-15-6-3-7-16-28)41-34-27-31-21-12-13-22-32(31)35-23-14-24-36(42(35)38(34)43)40(45)47-37(29-17-8-4-9-18-29)30-19-10-5-11-20-30/h3-13,15-22,33-37,41H,2,14,23-27H2,1H3/t33?,34-,35+,36-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.