
CAS 1116-61-6
:Tripropylborane
Description:
Tripropylborane is an organoboron compound characterized by its three propyl groups attached to a boron atom. It is a colorless, flammable liquid that is soluble in organic solvents but insoluble in water. This compound is known for its strong reducing properties and is often utilized in organic synthesis, particularly in hydroboration reactions, where it adds across double bonds to form organoboranes. Tripropylborane is also notable for its ability to form stable complexes with various substrates, making it valuable in the field of organometallic chemistry. Due to its reactivity, it must be handled with care, as it can react vigorously with oxidizing agents and moisture. Additionally, tripropylborane can be used as a reagent in the preparation of other boron-containing compounds, contributing to its significance in synthetic organic chemistry. Its unique properties and reactivity profile make it a useful tool for chemists working in various applications, including polymerization and the development of new materials.
Formula:C9H21B
InChI:InChI=1S/C9H21B/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3
InChI key:InChIKey=ZMPKTELQGVLZTD-UHFFFAOYSA-N
SMILES:B(CCC)(CCC)CCC
Synonyms:- Borane, tripropyl-
- Tripropylborane
- Borine, tripropyl-
- Tripropylboron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
