CymitQuimica logo

CAS 1116-82-1

:

3,3'-(nitrosoimino)dipropanenitrile

Description:
3,3'-(Nitrosoimino)dipropanenitrile, with the CAS number 1116-82-1, is a chemical compound characterized by its unique structure, which includes two propanenitrile groups connected by a nitrosoimino functional group. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in various chemical reactions. The presence of the nitrosoimino group imparts specific reactivity, making it a subject of interest in the study of nitrogen-containing compounds. Its molecular structure suggests that it may exhibit properties such as moderate stability under certain conditions, but it could also be sensitive to heat or light, which may lead to decomposition. Additionally, the compound's nitrile groups contribute to its polarity and solubility characteristics, influencing its behavior in different solvents. Safety data should be consulted, as compounds containing nitroso and nitrile functionalities can pose health risks and require careful handling. Overall, 3,3'-(nitrosoimino)dipropanenitrile is a notable compound in the realm of synthetic organic chemistry.
Formula:C6H8N4O
InChI:InChI=1/C6H8N4O/c7-3-1-5-10(9-11)6-2-4-8/h1-2,5-6H2
Synonyms:
  • propanenitrile, 3,3'-(nitrosoimino)bis-
  • Bis(2-cyanoethyl)nitrosamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.