CymitQuimica logo

CAS 111600-83-0

:

5-Bromo-4-methyl-1,3-thiazole

Description:
5-Bromo-4-methyl-1,3-thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of a bromine atom at the 5-position and a methyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. It exhibits moderate solubility in organic solvents, while its reactivity can be influenced by the electron-withdrawing nature of the bromine atom. The thiazole ring system is known for its role in various biochemical processes, making derivatives of this compound of interest in medicinal chemistry. Additionally, 5-Bromo-4-methyl-1,3-thiazole can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C4H4BrNS
InChI:InChI=1/C4H4BrNS/c1-3-4(5)7-2-6-3/h2H,1H3
InChI key:IIMLZWMRQNCPTM-UHFFFAOYSA-N
SMILES:Cc1c(Br)scn1
Synonyms:
  • Thiazole, 5-Bromo-4-Methyl-
  • 5-Bromo-4-methyl-thiazole
Found 4 products.