CymitQuimica logo

CAS 111607-91-1

:

fluoromethyl 2-methoxy-2-fluoro-1-(trifluoromethyl)vinyl ether

Description:
Fluoromethyl 2-methoxy-2-fluoro-1-(trifluoromethyl)vinyl ether, with the CAS number 111607-91-1, is a fluorinated organic compound characterized by its unique structure that includes both ether and vinyl functionalities. This compound features a trifluoromethyl group, which is known for imparting significant lipophilicity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms enhances the compound's chemical stability and alters its reactivity compared to non-fluorinated analogs. Additionally, the methoxy group contributes to its solubility properties and can influence its biological activity. The compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds. Its synthesis and handling require careful consideration of safety protocols due to the potential reactivity of fluorinated compounds. Overall, this substance exemplifies the growing interest in fluorinated materials in modern chemistry, particularly for their unique properties and applications in advanced materials and drug design.
Formula:C5H5F5O2
InChI:InChI=1/C5H5F5O2/c1-11-4(7)3(12-2-6)5(8,9)10/h2H2,1H3/b4-3-
SMILES:CO/C(=C(/C(F)(F)F)\OCF)/F
Synonyms:
  • 1,3,3,3-Tetrafluoro-2-(fluoromethoxy)-1-methoxy-1-propene
  • Fmftve
  • 1-Propene, 1,3,3,3-tetrafluoro-2-(fluoromethoxy)-1-methoxy-
  • (1E)-1,3,3,3-tetrafluoro-2-(fluoromethoxy)-1-methoxyprop-1-ene
  • Fluoromethyl 2-methoxy-2-fluoro-1-(trifluoromethyl)vinyl ether
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.