CAS 1116093-46-9

4-Bromo-3-cyclopentyl-1H-pyrazole

Description:

4-Bromo-3-cyclopentyl-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a cyclopentyl group at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazole moiety, which is known for its biological activity. Additionally, the bromine substituent can enhance reactivity and facilitate further chemical modifications. The cyclopentyl group may influence the compound's lipophilicity and steric properties, potentially affecting its interaction with biological targets. As with many pyrazole derivatives, 4-Bromo-3-cyclopentyl-1H-pyrazole may also exhibit interesting pharmacological properties, warranting further investigation in drug discovery and development.

Formula: C₈H₁₁BrN₂

InChI: InChI=1S/C8H11BrN2/c9-7-5-10-11-8(7)6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)

InChI key: InChIKey=TXVIOQGNPMZMMJ-UHFFFAOYSA-N

SMILES: BrC=1C(=NNC1)C2CCCC2

Synonyms:

• 1H-Pyrazole, 4-bromo-3-cyclopentyl-
• 4-Bromo-3-cyclopentyl-1H-pyrazole