
CAS 1116136-58-3
:7-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-amine
Description:
7-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. This compound features a methoxy group (-OCH3) at the 7-position and an amino group (-NH2) at the 3-position of the pyrrolo-pyridine framework. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and binding affinity to biological targets. As with many heterocycles, it may also display interesting electronic properties, making it a candidate for further research in pharmacology and material science. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-12-6-2-3-10-7-5(9)4-11-8(6)7/h2-4,11H,9H2,1H3
InChI key:InChIKey=XWYFXAQVFMNNHK-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(N)=CN2)=NC=C1
Synonyms:- 7-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-amine
- 1H-Pyrrolo[3,2-b]pyridin-3-amine, 7-methoxy-
- 3-Amino-7-methoxy-4-azaindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.