CAS 111628-39-8

2-PIPERAZIN-1-YL-BENZOOXAZOLE

Description:

2-Piperazin-1-yl-benzoxazole, with the CAS number 111628-39-8, is a chemical compound characterized by the presence of a benzoxazole moiety and a piperazine ring. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The benzoxazole structure provides a stable aromatic system, while the piperazine ring introduces basic nitrogen atoms, which can participate in hydrogen bonding and enhance solubility in polar solvents. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including activity against various biological targets. Its molecular structure suggests it could interact with neurotransmitter systems or exhibit antimicrobial properties. Additionally, the presence of both nitrogen and oxygen heteroatoms can influence its reactivity and stability under different conditions. As with many organic compounds, the specific characteristics, such as melting point, solubility, and reactivity, would depend on the purity and specific formulation of the substance.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1/C11H13N3O/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2

SMILES: c1ccc2c(c1)nc(N1CCNCC1)o2

Synonyms:

• 2-Piperazino-1,3-Benzoxazole
• Buttpark 120\07-01
• Chembrdg-Bb 4102378
• 2-(Piperazin-1-Yl)Benzo[D]Oxazole
• 2-(Piperazin-1-Yl)-1,3-Benzoxazole

2-Piperazin-1-yl-benzooxazole

CAS: 111628-39-8

Formula: C₁₁H₁₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.2404

Ref: IN-DA008RVG

2-Piperazin-1-yl-1,3-benzoxazole

CAS: 111628-39-8

2-Piperazin-1-yl-1,3-benzoxazole

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.24g/mol

Ref: 54-OR480292

2-Piperazin-1-yl-benzooxazole

CAS: 111628-39-8

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 203.2449951171875

Ref: 10-F029396