CAS 1116339-56-0
:4-(Trifluoromethyl)-2-quinolinemethanol
Description:
4-(Trifluoromethyl)-2-quinolinemethanol is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The hydroxyl group in the methanol part of the molecule can participate in hydrogen bonding, which may influence its reactivity and interactions with other substances. Additionally, compounds with similar structures are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their diverse biological activities and chemical reactivity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks. Overall, 4-(Trifluoromethyl)-2-quinolinemethanol represents a compound of interest in various fields of research and development.
Formula:C11H8F3NO
InChI:InChI=1S/C11H8F3NO/c12-11(13,14)9-5-7(6-16)15-10-4-2-1-3-8(9)10/h1-5,16H,6H2
InChI key:InChIKey=RAISYORPYPURGD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(CO)C1)C=CC=C2
Synonyms:- 2-Quinolinemethanol, 4-(trifluoromethyl)-
- 4-(Trifluoromethyl)-2-quinolinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
