CAS 1116339-57-1
:4-(Trifluoromethyl)-2-quinolinecarboxylic acid hydrazide
Description:
4-(Trifluoromethyl)-2-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a quinoline ring system and a trifluoromethyl group. This compound typically exhibits properties associated with both hydrazides and quinoline derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the hydrazide functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. It may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The presence of the quinoline moiety often correlates with various biological activities, including antimicrobial and antitumor effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in research and industry. Overall, 4-(Trifluoromethyl)-2-quinolinecarboxylic acid hydrazide represents a versatile structure with potential implications in drug development and chemical synthesis.
Formula:C11H8F3N3O
InChI:InChI=1S/C11H8F3N3O/c12-11(13,14)7-5-9(10(18)17-15)16-8-4-2-1-3-6(7)8/h1-5H,15H2,(H,17,18)
InChI key:InChIKey=FSXUUZNRIABWCE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(NN)=O)C1)C=CC=C2
Synonyms:- 2-Quinolinecarboxylic acid, 4-(trifluoromethyl)-, hydrazide
- 4-(Trifluoromethyl)-2-quinolinecarbohydrazide
- 4-(Trifluoromethyl)-2-quinolinecarboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
