CAS 1116339-61-7
:6-Fluoro-4-(trifluoromethyl)-2-quinolinecarboxamide
Description:
6-Fluoro-4-(trifluoromethyl)-2-quinolinecarboxamide is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a fluorine atom at the 6-position and a trifluoromethyl group at the 4-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the quinoline scaffold can lead to compounds with varied pharmacological activities. Its CAS number, 1116339-61-7, allows for precise identification in chemical databases. Overall, the combination of fluorine substituents and the quinoline framework suggests that this compound may exhibit interesting reactivity and biological properties, warranting further investigation in pharmaceutical research.
Formula:C11H6F4N2O
InChI:InChI=1S/C11H6F4N2O/c12-5-1-2-8-6(3-5)7(11(13,14)15)4-9(17-8)10(16)18/h1-4H,(H2,16,18)
InChI key:InChIKey=JMIFMZCJESMKFV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(N)=O)C1)C=CC(F)=C2
Synonyms:- 2-Quinolinecarboxamide, 6-fluoro-4-(trifluoromethyl)-
- 6-Fluoro-4-(trifluoromethyl)-2-quinolinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.