CymitQuimica logo

CAS 1116339-78-6

:

1-(5-bromo-4-nitroindoline)ethanone

Description:
1-(5-Bromo-4-nitroindoline)ethanone is an organic compound characterized by its indoline structure, which is a bicyclic compound containing a fused benzene and pyrrole ring. The presence of a bromine atom and a nitro group at specific positions on the indoline ring contributes to its unique chemical properties, including increased reactivity and potential for electrophilic substitution reactions. The ethanone functional group indicates the presence of a carbonyl (C=O) group, which can participate in various chemical reactions, such as nucleophilic addition. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in organic synthesis and materials science. Additionally, the presence of halogen and nitro substituents can influence the compound's solubility, stability, and interaction with other chemical species. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C10H9BrN2O3
InChI:InChI=1S/C10H9BrN2O3/c1-6(14)12-5-4-7-9(12)3-2-8(11)10(7)13(15)16/h2-3H,4-5H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.