
CAS 1116339-79-7
:2,6-Difluoro-4-hydroxybenzaldehyde oxime
Description:
2,6-Difluoro-4-hydroxybenzaldehyde oxime is an organic compound characterized by the presence of both aldehyde and hydroxyl functional groups, along with two fluorine substituents on the benzene ring. Its molecular structure features a benzene ring with a hydroxyl group (-OH) and an oxime group (-C=N-OH) attached to the aromatic system, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atoms enhance the compound's polarity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. Its oxime functionality can participate in various chemical reactions, including condensation and rearrangement reactions, making it a versatile intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H5F2NO2
InChI:InChI=1S/C7H5F2NO2/c8-6-1-4(11)2-7(9)5(6)3-10-12/h1-3,11-12H
InChI key:InChIKey=GXGKXSSRQPDALV-UHFFFAOYSA-N
SMILES:C(=NO)C1=C(F)C=C(O)C=C1F
Synonyms:- Benzaldehyde, 2,6-difluoro-4-hydroxy-, oxime
- 2,6-Difluoro-4-hydroxybenzaldehyde oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.