CAS 1116358-98-5

1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-5-oxo-2-naphthalenyl)carbamate

Description:

1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-5-oxo-2-naphthalenyl)carbamate, identified by its CAS number 1116358-98-5, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The compound also contains a naphthalene derivative, specifically a tetrahydro-5-oxo-naphthyl group, which may impart unique chemical reactivity and biological activity. Carbamates are known for their applications in various fields, including agriculture as pesticides and in pharmaceuticals. The presence of the naphthalene structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and solubility can be influenced by its functional groups, which may affect its behavior in different environments. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex interactions in biological and chemical systems.

Formula: C₁₅H₁₉NO₃

InChI: InChI=1S/C15H19NO3/c1-15(2,3)19-14(18)16-11-7-8-12-10(9-11)5-4-6-13(12)17/h7-9H,4-6H2,1-3H3,(H,16,18)

InChI key: InChIKey=MMPJJEUWBFZCPO-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(NC(OC(C)(C)C)=O)=CC2)CCC1

Synonyms:

• Carbamic acid, N-(5,6,7,8-tetrahydro-5-oxo-2-naphthalenyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-5-oxo-2-naphthalenyl)carbamate