CymitQuimica logo

CAS 111641-58-8

:

9,10-Anthracenedione, 1,5-diamino-, homopolymer

Description:
9,10-Anthracenedione, 1,5-diamino-, homopolymer, with the CAS number 111641-58-8, is a synthetic polymer derived from the polymerization of 1,5-diaminoanthraquinone and anthracenedione units. This compound exhibits notable characteristics such as high thermal stability and good solubility in various organic solvents, which makes it suitable for applications in organic electronics and as a dye. The polymer's structure, featuring anthracene moieties, contributes to its strong light-absorbing properties, making it useful in photonic devices. Additionally, it may exhibit semiconducting behavior, which is advantageous in electronic applications. The presence of amino groups in the polymer backbone can enhance its reactivity and potential for further functionalization, allowing for the development of composite materials or hybrid systems. Overall, this polymer is of interest in materials science and organic chemistry due to its unique properties and potential applications in advanced technologies.
Formula:(C14H10N2O2)x
InChI:InChI=1S/C14H10N2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H,15-16H2
InChI key:InChIKey=VWBVCOPVKXNMMZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3N)=CC=CC2N
Synonyms:
  • Poly(1,5-diaminoanthraquinone)
  • 1,5-Diaminoanthraquinone homopolymer
  • 9,10-Anthracenedione, 1,5-diamino-, homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.